About [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 1,3-diphenylpyrazole-4-carboxylate
[2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 1,3-diphenylpyrazole-4-carboxylate (PubChem CID 3352398) has the molecular formula C23H16Cl2N4O3
and a molecular weight of 467.31 g/mol. Its IUPAC name is [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 1,3-diphenylpyrazole-4-carboxylate.
Molecular Properties
| Compound Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 1,3-diphenylpyrazole-4-carboxylate |
| PubChem CID | 3352398 |
| Molecular Formula | C23H16Cl2N4O3 |
| Molecular Weight | 467.31 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 1,3-diphenylpyrazole-4-carboxylate |
| SMILES | O=C(COC(=O)c1cn(-c2ccccc2)nc1-c1ccccc1)Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C23H16Cl2N4O3/c24-16-11-19(25)22(26-12-16)27-20(30)14-32-23(31)18-13-29(17-9-5-2-6-10-17)28-21(18)15-7-3-1-4-8-15/h1-13H,14H2,(H,26,27,30) |
| InChIKey | PUMPJEZXXDPVJK-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.31 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 1,3-diphenylpyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 1,3-diphenylpyrazole-4-carboxylate?
The IUPAC name of [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 1,3-diphenylpyrazole-4-carboxylate (CID 3352398) is [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 1,3-diphenylpyrazole-4-carboxylate.
What is the SMILES notation for [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 1,3-diphenylpyrazole-4-carboxylate?
The canonical SMILES for [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 1,3-diphenylpyrazole-4-carboxylate is O=C(COC(=O)c1cn(-c2ccccc2)nc1-c1ccccc1)Nc1ncc(Cl)cc1Cl.
What is the InChIKey of [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 1,3-diphenylpyrazole-4-carboxylate?
The InChIKey is PUMPJEZXXDPVJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16Cl2N4O3/c24-16-11-19(25)22(26-12-16)27-20(30)14-32-23(31)18-13-29(17-9-5-2-6-10-17)28-21(18)15-7-3-1-4-8-15/h1-13H,14H2,(H,26,27,30).
What are the key properties of [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 1,3-diphenylpyrazole-4-carboxylate?
[2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 1,3-diphenylpyrazole-4-carboxylate has a molecular weight of 467.31 g/mol, XLogP of 5.04, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 1,3-diphenylpyrazole-4-carboxylate is sourced from PubChem (CID 3352398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).