C6H6N6OS — CID 3352880
3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carbothioamide (PubChem CID 3352880) has the molecular formula C6H6N6OS and a molecular weight of 210.22 g/mol. Its IUPAC name is 3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carbothioamide.
| Compound Name | 3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carbothioamide |
|---|---|
| PubChem CID | 3352880 |
| Molecular Formula | C6H6N6OS |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carbothioamide |
| SMILES | Cn1nnc2c(C(N)=S)ncn2c1=O |
| InChI | InChI=1S/C6H6N6OS/c1-11-6(13)12-2-8-3(4(7)14)5(12)9-10-11/h2H,1H3,(H2,7,14) |
| InChIKey | UNCSYWYTUBIMHD-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 91.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|