C14H14ClNO2 — CID 3352918
ethyl 4-chloro-6,8-dimethylquinoline-3-carboxylate (PubChem CID 3352918) has the molecular formula C14H14ClNO2 and a molecular weight of 263.72 g/mol. Its IUPAC name is ethyl 4-chloro-6,8-dimethylquinoline-3-carboxylate.
| Compound Name | ethyl 4-chloro-6,8-dimethylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 3352918 |
| Molecular Formula | C14H14ClNO2 |
| Molecular Weight | 263.72 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | ethyl 4-chloro-6,8-dimethylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(C)cc(C)cc2c1Cl |
| InChI | InChI=1S/C14H14ClNO2/c1-4-18-14(17)11-7-16-13-9(3)5-8(2)6-10(13)12(11)15/h5-7H,4H2,1-3H3 |
| InChIKey | QOCJKSWVYYUBSD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.72 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |