C37H34N2O7 — CID 3353229
2-(4-acetylphenyl)-6-(3-ethoxy-4-hydroxyphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3353229) has the molecular formula C37H34N2O7 and a molecular weight of 618.69 g/mol. Its IUPAC name is 2-(4-acetylphenyl)-6-(3-ethoxy-4-hydroxyphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(4-acetylphenyl)-6-(3-ethoxy-4-hydroxyphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3353229 |
| Molecular Formula | C37H34N2O7 |
| Molecular Weight | 618.69 g/mol |
| Exact Mass | 618.24 |
| IUPAC Name | 2-(4-acetylphenyl)-6-(3-ethoxy-4-hydroxyphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CCOc1cc(C2C3=CCC4C(=O)N(c5ccc(C(C)=O)cc5)C(=O)C4C3CC3C(=O)N(c4ccccc4)C(=O)C32C)ccc1O |
| InChI | InChI=1S/C37H34N2O7/c1-4-46-30-18-22(12-17-29(30)41)32-25-15-16-26-31(35(44)38(33(26)42)24-13-10-21(11-14-24)20(2)40)27(25)19-28-34(43)39(36(45)37(28,32)3)23-8-6-5-7-9-23/h5-15,17-18,26-28,31-32,41H,4,16,19H2,1-3H3 |
| InChIKey | AVJNSIAVNGRQJO-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.69 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|