C7H9N3S — CID 3353652
2-amino-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione (PubChem CID 3353652) has the molecular formula C7H9N3S and a molecular weight of 167.24 g/mol. Its IUPAC name is 2-amino-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione.
| Compound Name | 2-amino-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione |
|---|---|
| PubChem CID | 3353652 |
| Molecular Formula | C7H9N3S |
| Molecular Weight | 167.24 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 2-amino-1,5,6,7-tetrahydrocyclopenta[d]pyrimidine-4-thione |
| SMILES | Nc1nc(=S)c2c([nH]1)CCC2 |
| InChI | InChI=1S/C7H9N3S/c8-7-9-5-3-1-2-4(5)6(11)10-7/h1-3H2,(H3,8,9,10,11) |
| InChIKey | NQIRPVBDACDNTL-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|