C19H16BrFN4O2 — CID 3353957
3-(3-bromo-4-fluorophenyl)-6-imino-1-methyl-8-propyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 3353957) has the molecular formula C19H16BrFN4O2 and a molecular weight of 431.27 g/mol. Its IUPAC name is 3-(3-bromo-4-fluorophenyl)-6-imino-1-methyl-8-propyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 3-(3-bromo-4-fluorophenyl)-6-imino-1-methyl-8-propyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 3353957 |
| Molecular Formula | C19H16BrFN4O2 |
| Molecular Weight | 431.27 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | 3-(3-bromo-4-fluorophenyl)-6-imino-1-methyl-8-propyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(C)OC(c3ccc(F)c(Br)c3)C(C#N)(C#N)C1(C#N)C2CCC |
| InChI | InChI=1S/C19H16BrFN4O2/c1-3-4-14-17(2)26-15(11-5-6-13(21)12(20)7-11)18(8-22,9-23)19(14,10-24)16(25)27-17/h5-7,14-15,25H,3-4H2,1-2H3/b25-16- |
| InChIKey | SDUFYKXXRUHOEP-XYGWBWBKSA-N |
| XLogP | 4.34 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.27 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|