About Maltyl isobutyrate
Maltyl isobutyrate (PubChem CID 3354132) has the molecular formula C10H12O4
and a molecular weight of 196.20 g/mol. Its IUPAC name is (2-methyl-4-oxopyran-3-yl) 2-methylpropanoate.
Molecular Properties
| Compound Name | Maltyl isobutyrate |
| PubChem CID | 3354132 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (2-methyl-4-oxopyran-3-yl) 2-methylpropanoate |
| SMILES | CC1=C(C(=O)C=CO1)OC(=O)C(C)C |
| InChI | InChI=1S/C10H12O4/c1-6(2)10(12)14-9-7(3)13-5-4-8(9)11/h4-6H,1-3H3 |
| InChIKey | VSBHYRPUJHEOBE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | 323 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Maltyl isobutyrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Maltyl isobutyrate?
The IUPAC name of Maltyl isobutyrate (CID 3354132) is (2-methyl-4-oxopyran-3-yl) 2-methylpropanoate.
What is the SMILES notation for Maltyl isobutyrate?
The canonical SMILES for Maltyl isobutyrate is CC1=C(C(=O)C=CO1)OC(=O)C(C)C.
What is the InChIKey of Maltyl isobutyrate?
The InChIKey is VSBHYRPUJHEOBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O4/c1-6(2)10(12)14-9-7(3)13-5-4-8(9)11/h4-6H,1-3H3.
What are the key properties of Maltyl isobutyrate?
Maltyl isobutyrate has a molecular weight of 196.20 g/mol, XLogP of 1.50, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Maltyl isobutyrate is sourced from PubChem (CID 3354132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).