4-iodobutanoic acid

C4H7IO2 — CID 3354774

IUPAC4-iodobutanoic acid
SMILESO=C(O)CCCI
InChIInChI=1S/C4H7IO2/c5-3-1-2-4(6)7/h1-3H2,(H,6,7)
InChIKeyHALXOXQZONRCAB-UHFFFAOYSA-N
MW214.00 g/mol
LogP1.29
Rot. Bonds3

About 4-iodobutanoic acid

4-iodobutanoic acid (PubChem CID 3354774) has the molecular formula C4H7IO2 and a molecular weight of 214.00 g/mol. Its IUPAC name is 4-iodobutanoic acid.

Molecular Properties

Compound Name4-iodobutanoic acid
PubChem CID3354774
Molecular FormulaC4H7IO2
Molecular Weight214.00 g/mol
Exact Mass213.95
IUPAC Name4-iodobutanoic acid
SMILESO=C(O)CCCI
InChIInChI=1S/C4H7IO2/c5-3-1-2-4(6)7/h1-3H2,(H,6,7)
InChIKeyHALXOXQZONRCAB-UHFFFAOYSA-N
XLogP1.29
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms7
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.00
LogP ≤ 51.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 4-iodobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-iodobutanoic acid?
The IUPAC name of 4-iodobutanoic acid (CID 3354774) is 4-iodobutanoic acid.
What is the SMILES notation for 4-iodobutanoic acid?
The canonical SMILES for 4-iodobutanoic acid is O=C(O)CCCI.
What is the InChIKey of 4-iodobutanoic acid?
The InChIKey is HALXOXQZONRCAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7IO2/c5-3-1-2-4(6)7/h1-3H2,(H,6,7).
What are the key properties of 4-iodobutanoic acid?
4-iodobutanoic acid has a molecular weight of 214.00 g/mol, XLogP of 1.29, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodobutanoic acid is sourced from PubChem (CID 3354774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).