About N'-(5-benzyl-4,5-dihydro-1,3-thiazol-2-yl)benzenesulfonohydrazide
N'-(5-benzyl-4,5-dihydro-1,3-thiazol-2-yl)benzenesulfonohydrazide (PubChem CID 3354995) has the molecular formula C16H17N3O2S2
and a molecular weight of 347.47 g/mol. Its IUPAC name is N'-(5-benzyl-4,5-dihydro-1,3-thiazol-2-yl)benzenesulfonohydrazide.
Molecular Properties
| Compound Name | N'-(5-benzyl-4,5-dihydro-1,3-thiazol-2-yl)benzenesulfonohydrazide |
| PubChem CID | 3354995 |
| Molecular Formula | C16H17N3O2S2 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | N'-(5-benzyl-4,5-dihydro-1,3-thiazol-2-yl)benzenesulfonohydrazide |
| SMILES | O=S(=O)(NNC1=NCC(Cc2ccccc2)S1)c1ccccc1 |
| InChI | InChI=1S/C16H17N3O2S2/c20-23(21,15-9-5-2-6-10-15)19-18-16-17-12-14(22-16)11-13-7-3-1-4-8-13/h1-10,14,19H,11-12H2,(H,17,18) |
| InChIKey | UTCSGMFFUKLVKI-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(5-benzyl-4,5-dihydro-1,3-thiazol-2-yl)benzenesulfonohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5-benzyl-4,5-dihydro-1,3-thiazol-2-yl)benzenesulfonohydrazide?
The IUPAC name of N'-(5-benzyl-4,5-dihydro-1,3-thiazol-2-yl)benzenesulfonohydrazide (CID 3354995) is N'-(5-benzyl-4,5-dihydro-1,3-thiazol-2-yl)benzenesulfonohydrazide.
What is the SMILES notation for N'-(5-benzyl-4,5-dihydro-1,3-thiazol-2-yl)benzenesulfonohydrazide?
The canonical SMILES for N'-(5-benzyl-4,5-dihydro-1,3-thiazol-2-yl)benzenesulfonohydrazide is O=S(=O)(NNC1=NCC(Cc2ccccc2)S1)c1ccccc1.
What is the InChIKey of N'-(5-benzyl-4,5-dihydro-1,3-thiazol-2-yl)benzenesulfonohydrazide?
The InChIKey is UTCSGMFFUKLVKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O2S2/c20-23(21,15-9-5-2-6-10-15)19-18-16-17-12-14(22-16)11-13-7-3-1-4-8-13/h1-10,14,19H,11-12H2,(H,17,18).
What are the key properties of N'-(5-benzyl-4,5-dihydro-1,3-thiazol-2-yl)benzenesulfonohydrazide?
N'-(5-benzyl-4,5-dihydro-1,3-thiazol-2-yl)benzenesulfonohydrazide has a molecular weight of 347.47 g/mol, XLogP of 2.18, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5-benzyl-4,5-dihydro-1,3-thiazol-2-yl)benzenesulfonohydrazide is sourced from PubChem (CID 3354995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).