About 2-bromo-N,N,5-trimethylaniline
2-bromo-N,N,5-trimethylaniline (PubChem CID 3355354) has the molecular formula C9H12BrN
and a molecular weight of 214.11 g/mol. Its IUPAC name is 2-bromo-N,N,5-trimethylaniline.
Molecular Properties
| Compound Name | 2-bromo-N,N,5-trimethylaniline |
| PubChem CID | 3355354 |
| Molecular Formula | C9H12BrN |
| Molecular Weight | 214.11 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | 2-bromo-N,N,5-trimethylaniline |
| SMILES | Cc1ccc(Br)c(N(C)C)c1 |
| InChI | InChI=1S/C9H12BrN/c1-7-4-5-8(10)9(6-7)11(2)3/h4-6H,1-3H3 |
| InChIKey | QRPSRXIDVBOPCC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.11 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-N,N,5-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N,N,5-trimethylaniline?
The IUPAC name of 2-bromo-N,N,5-trimethylaniline (CID 3355354) is 2-bromo-N,N,5-trimethylaniline.
What is the SMILES notation for 2-bromo-N,N,5-trimethylaniline?
The canonical SMILES for 2-bromo-N,N,5-trimethylaniline is Cc1ccc(Br)c(N(C)C)c1.
What is the InChIKey of 2-bromo-N,N,5-trimethylaniline?
The InChIKey is QRPSRXIDVBOPCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrN/c1-7-4-5-8(10)9(6-7)11(2)3/h4-6H,1-3H3.
What are the key properties of 2-bromo-N,N,5-trimethylaniline?
2-bromo-N,N,5-trimethylaniline has a molecular weight of 214.11 g/mol, XLogP of 2.82, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N,N,5-trimethylaniline is sourced from PubChem (CID 3355354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).