About [2-(4-methylphenyl)-1,3-thiazolidin-3-yl]-(4-nitrophenyl)methanone
[2-(4-methylphenyl)-1,3-thiazolidin-3-yl]-(4-nitrophenyl)methanone (PubChem CID 3355389) has the molecular formula C17H16N2O3S
and a molecular weight of 328.39 g/mol. Its IUPAC name is [2-(4-methylphenyl)-1,3-thiazolidin-3-yl]-(4-nitrophenyl)methanone.
Molecular Properties
| Compound Name | [2-(4-methylphenyl)-1,3-thiazolidin-3-yl]-(4-nitrophenyl)methanone |
| PubChem CID | 3355389 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | [2-(4-methylphenyl)-1,3-thiazolidin-3-yl]-(4-nitrophenyl)methanone |
| SMILES | Cc1ccc(C2SCCN2C(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C17H16N2O3S/c1-12-2-4-14(5-3-12)17-18(10-11-23-17)16(20)13-6-8-15(9-7-13)19(21)22/h2-9,17H,10-11H2,1H3 |
| InChIKey | URUHSVUUYGSFBK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-methylphenyl)-1,3-thiazolidin-3-yl]-(4-nitrophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-methylphenyl)-1,3-thiazolidin-3-yl]-(4-nitrophenyl)methanone?
The IUPAC name of [2-(4-methylphenyl)-1,3-thiazolidin-3-yl]-(4-nitrophenyl)methanone (CID 3355389) is [2-(4-methylphenyl)-1,3-thiazolidin-3-yl]-(4-nitrophenyl)methanone.
What is the SMILES notation for [2-(4-methylphenyl)-1,3-thiazolidin-3-yl]-(4-nitrophenyl)methanone?
The canonical SMILES for [2-(4-methylphenyl)-1,3-thiazolidin-3-yl]-(4-nitrophenyl)methanone is Cc1ccc(C2SCCN2C(=O)c2ccc([N+](=O)[O-])cc2)cc1.
What is the InChIKey of [2-(4-methylphenyl)-1,3-thiazolidin-3-yl]-(4-nitrophenyl)methanone?
The InChIKey is URUHSVUUYGSFBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O3S/c1-12-2-4-14(5-3-12)17-18(10-11-23-17)16(20)13-6-8-15(9-7-13)19(21)22/h2-9,17H,10-11H2,1H3.
What are the key properties of [2-(4-methylphenyl)-1,3-thiazolidin-3-yl]-(4-nitrophenyl)methanone?
[2-(4-methylphenyl)-1,3-thiazolidin-3-yl]-(4-nitrophenyl)methanone has a molecular weight of 328.39 g/mol, XLogP of 3.79, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-methylphenyl)-1,3-thiazolidin-3-yl]-(4-nitrophenyl)methanone is sourced from PubChem (CID 3355389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).