C25H33N5O3S2 — CID 3355522
3-(2-methoxyethyl)-5-[[7-methyl-4-oxo-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3355522) has the molecular formula C25H33N5O3S2 and a molecular weight of 515.71 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-5-[[7-methyl-4-oxo-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(2-methoxyethyl)-5-[[7-methyl-4-oxo-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3355522 |
| Molecular Formula | C25H33N5O3S2 |
| Molecular Weight | 515.71 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | 3-(2-methoxyethyl)-5-[[7-methyl-4-oxo-2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrido[1,2-a]pyrimidin-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COCCN1C(=O)C(=Cc2c(NC3CC(C)(C)NC(C)(C)C3)nc3ccc(C)cn3c2=O)SC1=S |
| InChI | InChI=1S/C25H33N5O3S2/c1-15-7-8-19-27-20(26-16-12-24(2,3)28-25(4,5)13-16)17(21(31)30(19)14-15)11-18-22(32)29(9-10-33-6)23(34)35-18/h7-8,11,14,16,26,28H,9-10,12-13H2,1-6H3 |
| InChIKey | KZSVXGLEAIGCAF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.71 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|