About 5-(3-chlorophenyl)-N-[(2,5-dimethoxyphenyl)methyl]-1-methylimidazol-2-amine
5-(3-chlorophenyl)-N-[(2,5-dimethoxyphenyl)methyl]-1-methylimidazol-2-amine (PubChem CID 3356531) has the molecular formula C19H20ClN3O2
and a molecular weight of 357.84 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-N-[(2,5-dimethoxyphenyl)methyl]-1-methylimidazol-2-amine.
Molecular Properties
| Compound Name | 5-(3-chlorophenyl)-N-[(2,5-dimethoxyphenyl)methyl]-1-methylimidazol-2-amine |
| PubChem CID | 3356531 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 5-(3-chlorophenyl)-N-[(2,5-dimethoxyphenyl)methyl]-1-methylimidazol-2-amine |
| SMILES | COc1ccc(OC)c(CNc2ncc(-c3cccc(Cl)c3)n2C)c1 |
| InChI | InChI=1S/C19H20ClN3O2/c1-23-17(13-5-4-6-15(20)9-13)12-22-19(23)21-11-14-10-16(24-2)7-8-18(14)25-3/h4-10,12H,11H2,1-3H3,(H,21,22) |
| InChIKey | OREBUXYTWWFVFG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(3-chlorophenyl)-N-[(2,5-dimethoxyphenyl)methyl]-1-methylimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-chlorophenyl)-N-[(2,5-dimethoxyphenyl)methyl]-1-methylimidazol-2-amine?
The IUPAC name of 5-(3-chlorophenyl)-N-[(2,5-dimethoxyphenyl)methyl]-1-methylimidazol-2-amine (CID 3356531) is 5-(3-chlorophenyl)-N-[(2,5-dimethoxyphenyl)methyl]-1-methylimidazol-2-amine.
What is the SMILES notation for 5-(3-chlorophenyl)-N-[(2,5-dimethoxyphenyl)methyl]-1-methylimidazol-2-amine?
The canonical SMILES for 5-(3-chlorophenyl)-N-[(2,5-dimethoxyphenyl)methyl]-1-methylimidazol-2-amine is COc1ccc(OC)c(CNc2ncc(-c3cccc(Cl)c3)n2C)c1.
What is the InChIKey of 5-(3-chlorophenyl)-N-[(2,5-dimethoxyphenyl)methyl]-1-methylimidazol-2-amine?
The InChIKey is OREBUXYTWWFVFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20ClN3O2/c1-23-17(13-5-4-6-15(20)9-13)12-22-19(23)21-11-14-10-16(24-2)7-8-18(14)25-3/h4-10,12H,11H2,1-3H3,(H,21,22).
What are the key properties of 5-(3-chlorophenyl)-N-[(2,5-dimethoxyphenyl)methyl]-1-methylimidazol-2-amine?
5-(3-chlorophenyl)-N-[(2,5-dimethoxyphenyl)methyl]-1-methylimidazol-2-amine has a molecular weight of 357.84 g/mol, XLogP of 4.37, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-chlorophenyl)-N-[(2,5-dimethoxyphenyl)methyl]-1-methylimidazol-2-amine is sourced from PubChem (CID 3356531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).