About 7,9-dihydro-3H-purine-2,8-dithione
7,9-dihydro-3H-purine-2,8-dithione (PubChem CID 3356743) has the molecular formula C5H4N4S2
and a molecular weight of 184.25 g/mol. Its IUPAC name is 7,9-dihydro-3H-purine-2,8-dithione.
Molecular Properties
| Compound Name | 7,9-dihydro-3H-purine-2,8-dithione |
| PubChem CID | 3356743 |
| Molecular Formula | C5H4N4S2 |
| Molecular Weight | 184.25 g/mol |
| Exact Mass | 183.99 |
| IUPAC Name | 7,9-dihydro-3H-purine-2,8-dithione |
| SMILES | S=c1ncc2[nH]c(=S)[nH]c2[nH]1 |
| InChI | InChI=1S/C5H4N4S2/c10-4-6-1-2-3(8-4)9-5(11)7-2/h1H,(H3,6,7,8,9,10,11) |
| InChIKey | GBAZMCPSNXEWPF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 60.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 7,9-dihydro-3H-purine-2,8-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,9-dihydro-3H-purine-2,8-dithione?
The IUPAC name of 7,9-dihydro-3H-purine-2,8-dithione (CID 3356743) is 7,9-dihydro-3H-purine-2,8-dithione.
What is the SMILES notation for 7,9-dihydro-3H-purine-2,8-dithione?
The canonical SMILES for 7,9-dihydro-3H-purine-2,8-dithione is S=c1ncc2[nH]c(=S)[nH]c2[nH]1.
What is the InChIKey of 7,9-dihydro-3H-purine-2,8-dithione?
The InChIKey is GBAZMCPSNXEWPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4S2/c10-4-6-1-2-3(8-4)9-5(11)7-2/h1H,(H3,6,7,8,9,10,11).
What are the key properties of 7,9-dihydro-3H-purine-2,8-dithione?
7,9-dihydro-3H-purine-2,8-dithione has a molecular weight of 184.25 g/mol, XLogP of 1.68, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,9-dihydro-3H-purine-2,8-dithione is sourced from PubChem (CID 3356743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).