C37H48F3NO6 — CID 3357033
ethyl N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(3-methoxypropyl)carbamate (PubChem CID 3357033) has the molecular formula C37H48F3NO6 and a molecular weight of 659.79 g/mol. Its IUPAC name is ethyl N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(3-methoxypropyl)carbamate.
| Compound Name | ethyl N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(3-methoxypropyl)carbamate |
|---|---|
| PubChem CID | 3357033 |
| Molecular Formula | C37H48F3NO6 |
| Molecular Weight | 659.79 g/mol |
| Exact Mass | 659.34 |
| IUPAC Name | ethyl N-[[5,13-dihydroxy-6,10-dimethyl-17-[3-(trifluoromethyl)benzoyl]-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-(3-methoxypropyl)carbamate |
| SMILES | CCOC(=O)N(CCCOC)CC1(O)CCC2c3ccc(cc3C(=O)c3cccc(C(F)(F)F)c3)CC(O)CCC(C)=CCCC21C |
| InChI | InChI=1S/C37H48F3NO6/c1-5-47-34(44)41(19-8-20-46-4)24-36(45)18-16-32-30-15-13-26(21-29(42)14-12-25(2)9-7-17-35(32,36)3)22-31(30)33(43)27-10-6-11-28(23-27)37(38,39)40/h6,9-11,13,15,22-23,29,32,42,45H,5,7-8,12,14,16-21,24H2,1-4H3 |
| InChIKey | ZTXNSVUYCQVFOU-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.79 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|