About 2-[2-(3-fluoroanilino)-1,3-thiazol-4-yl]benzo[f]chromen-3-one
2-[2-(3-fluoroanilino)-1,3-thiazol-4-yl]benzo[f]chromen-3-one (PubChem CID 3357378) has the molecular formula C22H13FN2O2S
and a molecular weight of 388.42 g/mol. Its IUPAC name is 2-[2-(3-fluoroanilino)-1,3-thiazol-4-yl]benzo[f]chromen-3-one.
Molecular Properties
| Compound Name | 2-[2-(3-fluoroanilino)-1,3-thiazol-4-yl]benzo[f]chromen-3-one |
| PubChem CID | 3357378 |
| Molecular Formula | C22H13FN2O2S |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 2-[2-(3-fluoroanilino)-1,3-thiazol-4-yl]benzo[f]chromen-3-one |
| SMILES | O=c1oc2ccc3ccccc3c2cc1-c1csc(Nc2cccc(F)c2)n1 |
| InChI | InChI=1S/C22H13FN2O2S/c23-14-5-3-6-15(10-14)24-22-25-19(12-28-22)18-11-17-16-7-2-1-4-13(16)8-9-20(17)27-21(18)26/h1-12H,(H,24,25) |
| InChIKey | PVZDTZYKUNQSHP-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(3-fluoroanilino)-1,3-thiazol-4-yl]benzo[f]chromen-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3-fluoroanilino)-1,3-thiazol-4-yl]benzo[f]chromen-3-one?
The IUPAC name of 2-[2-(3-fluoroanilino)-1,3-thiazol-4-yl]benzo[f]chromen-3-one (CID 3357378) is 2-[2-(3-fluoroanilino)-1,3-thiazol-4-yl]benzo[f]chromen-3-one.
What is the SMILES notation for 2-[2-(3-fluoroanilino)-1,3-thiazol-4-yl]benzo[f]chromen-3-one?
The canonical SMILES for 2-[2-(3-fluoroanilino)-1,3-thiazol-4-yl]benzo[f]chromen-3-one is O=c1oc2ccc3ccccc3c2cc1-c1csc(Nc2cccc(F)c2)n1.
What is the InChIKey of 2-[2-(3-fluoroanilino)-1,3-thiazol-4-yl]benzo[f]chromen-3-one?
The InChIKey is PVZDTZYKUNQSHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H13FN2O2S/c23-14-5-3-6-15(10-14)24-22-25-19(12-28-22)18-11-17-16-7-2-1-4-13(16)8-9-20(17)27-21(18)26/h1-12H,(H,24,25).
What are the key properties of 2-[2-(3-fluoroanilino)-1,3-thiazol-4-yl]benzo[f]chromen-3-one?
2-[2-(3-fluoroanilino)-1,3-thiazol-4-yl]benzo[f]chromen-3-one has a molecular weight of 388.42 g/mol, XLogP of 5.95, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3-fluoroanilino)-1,3-thiazol-4-yl]benzo[f]chromen-3-one is sourced from PubChem (CID 3357378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).