C22H13FN2O2S — CID 3357378
2-[2-(3-fluoroanilino)-1,3-thiazol-4-yl]benzo[f]chromen-3-one (PubChem CID 3357378) has the molecular formula C22H13FN2O2S and a molecular weight of 388.42 g/mol. Its IUPAC name is 2-[2-(3-fluoroanilino)-1,3-thiazol-4-yl]benzo[f]chromen-3-one.
| Compound Name | 2-[2-(3-fluoroanilino)-1,3-thiazol-4-yl]benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 3357378 |
| Molecular Formula | C22H13FN2O2S |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 2-[2-(3-fluoroanilino)-1,3-thiazol-4-yl]benzo[f]chromen-3-one |
| SMILES | O=c1oc2ccc3ccccc3c2cc1-c1csc(Nc2cccc(F)c2)n1 |
| InChI | InChI=1S/C22H13FN2O2S/c23-14-5-3-6-15(10-14)24-22-25-19(12-28-22)18-11-17-16-7-2-1-4-13(16)8-9-20(17)27-21(18)26/h1-12H,(H,24,25) |
| InChIKey | PVZDTZYKUNQSHP-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|