About 2-iminopyrido[3,2-e][1,3]thiazin-4-amine
2-iminopyrido[3,2-e][1,3]thiazin-4-amine (PubChem CID 3357838) has the molecular formula C7H6N4S
and a molecular weight of 178.22 g/mol. Its IUPAC name is 2-iminopyrido[3,2-e][1,3]thiazin-4-amine.
Molecular Properties
| Compound Name | 2-iminopyrido[3,2-e][1,3]thiazin-4-amine |
| PubChem CID | 3357838 |
| Molecular Formula | C7H6N4S |
| Molecular Weight | 178.22 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | 2-iminopyrido[3,2-e][1,3]thiazin-4-amine |
| SMILES | [H]/N=c1/nc(N)c2cccnc2s1 |
| InChI | InChI=1S/C7H6N4S/c8-5-4-2-1-3-10-6(4)12-7(9)11-5/h1-3H,(H3,8,9,11) |
| InChIKey | AVMSTISLRCBKJB-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.22 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-iminopyrido[3,2-e][1,3]thiazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iminopyrido[3,2-e][1,3]thiazin-4-amine?
The IUPAC name of 2-iminopyrido[3,2-e][1,3]thiazin-4-amine (CID 3357838) is 2-iminopyrido[3,2-e][1,3]thiazin-4-amine.
What is the SMILES notation for 2-iminopyrido[3,2-e][1,3]thiazin-4-amine?
The canonical SMILES for 2-iminopyrido[3,2-e][1,3]thiazin-4-amine is [H]/N=c1/nc(N)c2cccnc2s1.
What is the InChIKey of 2-iminopyrido[3,2-e][1,3]thiazin-4-amine?
The InChIKey is AVMSTISLRCBKJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4S/c8-5-4-2-1-3-10-6(4)12-7(9)11-5/h1-3H,(H3,8,9,11).
What are the key properties of 2-iminopyrido[3,2-e][1,3]thiazin-4-amine?
2-iminopyrido[3,2-e][1,3]thiazin-4-amine has a molecular weight of 178.22 g/mol, XLogP of 0.75, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iminopyrido[3,2-e][1,3]thiazin-4-amine is sourced from PubChem (CID 3357838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).