About 1-(3,5-dimethylpyrazol-1-yl)-N,1-diphenylmethanimine
1-(3,5-dimethylpyrazol-1-yl)-N,1-diphenylmethanimine (PubChem CID 3357892) has the molecular formula C18H17N3
and a molecular weight of 275.36 g/mol. Its IUPAC name is 1-(3,5-dimethylpyrazol-1-yl)-N,1-diphenylmethanimine.
Molecular Properties
| Compound Name | 1-(3,5-dimethylpyrazol-1-yl)-N,1-diphenylmethanimine |
| PubChem CID | 3357892 |
| Molecular Formula | C18H17N3 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 1-(3,5-dimethylpyrazol-1-yl)-N,1-diphenylmethanimine |
| SMILES | Cc1cc(C)n(/C(=N\c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C18H17N3/c1-14-13-15(2)21(20-14)18(16-9-5-3-6-10-16)19-17-11-7-4-8-12-17/h3-13H,1-2H3/b19-18- |
| InChIKey | SQWDNYWELKNHIG-HNENSFHCSA-N |
| XLogP | 4.13 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,5-dimethylpyrazol-1-yl)-N,1-diphenylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dimethylpyrazol-1-yl)-N,1-diphenylmethanimine?
The IUPAC name of 1-(3,5-dimethylpyrazol-1-yl)-N,1-diphenylmethanimine (CID 3357892) is 1-(3,5-dimethylpyrazol-1-yl)-N,1-diphenylmethanimine.
What is the SMILES notation for 1-(3,5-dimethylpyrazol-1-yl)-N,1-diphenylmethanimine?
The canonical SMILES for 1-(3,5-dimethylpyrazol-1-yl)-N,1-diphenylmethanimine is Cc1cc(C)n(/C(=N\c2ccccc2)c2ccccc2)n1.
What is the InChIKey of 1-(3,5-dimethylpyrazol-1-yl)-N,1-diphenylmethanimine?
The InChIKey is SQWDNYWELKNHIG-HNENSFHCSA-N. The full InChI is InChI=1S/C18H17N3/c1-14-13-15(2)21(20-14)18(16-9-5-3-6-10-16)19-17-11-7-4-8-12-17/h3-13H,1-2H3/b19-18-.
What are the key properties of 1-(3,5-dimethylpyrazol-1-yl)-N,1-diphenylmethanimine?
1-(3,5-dimethylpyrazol-1-yl)-N,1-diphenylmethanimine has a molecular weight of 275.36 g/mol, XLogP of 4.13, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dimethylpyrazol-1-yl)-N,1-diphenylmethanimine is sourced from PubChem (CID 3357892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).