About N-cyclohexyl-5-methyl-1,2-oxazole-4-carboxamide
N-cyclohexyl-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 3358009) has the molecular formula C11H16N2O2
and a molecular weight of 208.26 g/mol. Its IUPAC name is N-cyclohexyl-5-methyl-1,2-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-cyclohexyl-5-methyl-1,2-oxazole-4-carboxamide |
| PubChem CID | 3358009 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | N-cyclohexyl-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1oncc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C11H16N2O2/c1-8-10(7-12-15-8)11(14)13-9-5-3-2-4-6-9/h7,9H,2-6H2,1H3,(H,13,14) |
| InChIKey | CLGIQVNBJWCESK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclohexyl-5-methyl-1,2-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-5-methyl-1,2-oxazole-4-carboxamide?
The IUPAC name of N-cyclohexyl-5-methyl-1,2-oxazole-4-carboxamide (CID 3358009) is N-cyclohexyl-5-methyl-1,2-oxazole-4-carboxamide.
What is the SMILES notation for N-cyclohexyl-5-methyl-1,2-oxazole-4-carboxamide?
The canonical SMILES for N-cyclohexyl-5-methyl-1,2-oxazole-4-carboxamide is Cc1oncc1C(=O)NC1CCCCC1.
What is the InChIKey of N-cyclohexyl-5-methyl-1,2-oxazole-4-carboxamide?
The InChIKey is CLGIQVNBJWCESK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2/c1-8-10(7-12-15-8)11(14)13-9-5-3-2-4-6-9/h7,9H,2-6H2,1H3,(H,13,14).
What are the key properties of N-cyclohexyl-5-methyl-1,2-oxazole-4-carboxamide?
N-cyclohexyl-5-methyl-1,2-oxazole-4-carboxamide has a molecular weight of 208.26 g/mol, XLogP of 2.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-5-methyl-1,2-oxazole-4-carboxamide is sourced from PubChem (CID 3358009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).