C22H15F2IN2O2 — CID 3358730
7-fluoro-5-(4-fluorophenyl)-4-(2-iodobenzoyl)-3,5-dihydro-1H-1,4-benzodiazepin-2-one (PubChem CID 3358730) has the molecular formula C22H15F2IN2O2 and a molecular weight of 504.27 g/mol. Its IUPAC name is 7-fluoro-5-(4-fluorophenyl)-4-(2-iodobenzoyl)-3,5-dihydro-1H-1,4-benzodiazepin-2-one.
| Compound Name | 7-fluoro-5-(4-fluorophenyl)-4-(2-iodobenzoyl)-3,5-dihydro-1H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 3358730 |
| Molecular Formula | C22H15F2IN2O2 |
| Molecular Weight | 504.27 g/mol |
| Exact Mass | 504.01 |
| IUPAC Name | 7-fluoro-5-(4-fluorophenyl)-4-(2-iodobenzoyl)-3,5-dihydro-1H-1,4-benzodiazepin-2-one |
| SMILES | O=C1CN(C(=O)c2ccccc2I)C(c2ccc(F)cc2)c2cc(F)ccc2N1 |
| InChI | InChI=1S/C22H15F2IN2O2/c23-14-7-5-13(6-8-14)21-17-11-15(24)9-10-19(17)26-20(28)12-27(21)22(29)16-3-1-2-4-18(16)25/h1-11,21H,12H2,(H,26,28) |
| InChIKey | CLYGQDPDKQOCRB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.27 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|