C25H32N4OS — CID 3358801
N-(4-butyl-2-methylphenyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carbothioamide (PubChem CID 3358801) has the molecular formula C25H32N4OS and a molecular weight of 436.63 g/mol. Its IUPAC name is N-(4-butyl-2-methylphenyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carbothioamide.
| Compound Name | N-(4-butyl-2-methylphenyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carbothioamide |
|---|---|
| PubChem CID | 3358801 |
| Molecular Formula | C25H32N4OS |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | N-(4-butyl-2-methylphenyl)-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carbothioamide |
| SMILES | CCCCc1ccc(NC(=S)N2CCC3(CC2)C(=O)NCN3c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C25H32N4OS/c1-3-4-8-20-11-12-22(19(2)17-20)27-24(31)28-15-13-25(14-16-28)23(30)26-18-29(25)21-9-6-5-7-10-21/h5-7,9-12,17H,3-4,8,13-16,18H2,1-2H3,(H,26,30)(H,27,31) |
| InChIKey | JGBBAPAPUWAWCO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|