C42H46N6O2+2 — CID 3359
N,N'-bis[2-(10-methoxy-7H-pyrido[4,3-c]carbazol-2-ium-2-yl)ethyl]hexane-1,6-diamine (PubChem CID 3359) has the molecular formula C42H46N6O2+2 and a molecular weight of 666.87 g/mol. Its IUPAC name is N,N'-bis[2-(10-methoxy-7H-pyrido[4,3-c]carbazol-2-ium-2-yl)ethyl]hexane-1,6-diamine.
| Compound Name | N,N'-bis[2-(10-methoxy-7H-pyrido[4,3-c]carbazol-2-ium-2-yl)ethyl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 3359 |
| Molecular Formula | C42H46N6O2+2 |
| Molecular Weight | 666.87 g/mol |
| Exact Mass | 666.37 |
| IUPAC Name | N,N'-bis[2-(10-methoxy-7H-pyrido[4,3-c]carbazol-2-ium-2-yl)ethyl]hexane-1,6-diamine |
| SMILES | COc1ccc2[nH]c3ccc4cc[n+](CCNCCCCCCNCC[n+]5ccc6ccc7[nH]c8ccc(OC)cc8c7c6c5)cc4c3c2c1 |
| InChI | InChI=1S/C42H44N6O2/c1-49-31-9-13-37-33(25-31)41-35-27-47(21-15-29(35)7-11-39(41)45-37)23-19-43-17-5-3-4-6-18-44-20-24-48-22-16-30-8-12-40-42(36(30)28-48)34-26-32(50-2)10-14-38(34)46-40/h7-16,21-22,25-28,43-44H,3-6,17-20,23-24H2,1-2H3/p+2 |
| InChIKey | VJZICIMRPZDSEJ-UHFFFAOYSA-P |
| XLogP | 7.29 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.87 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|