About 4-triphenylsilylphenol
4-triphenylsilylphenol (PubChem CID 3359842) has the molecular formula C24H20OSi
and a molecular weight of 352.51 g/mol. Its IUPAC name is 4-triphenylsilylphenol.
Molecular Properties
| Compound Name | 4-triphenylsilylphenol |
| PubChem CID | 3359842 |
| Molecular Formula | C24H20OSi |
| Molecular Weight | 352.51 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 4-triphenylsilylphenol |
| SMILES | Oc1ccc([Si](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20OSi/c25-20-16-18-24(19-17-20)26(21-10-4-1-5-11-21,22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-19,25H |
| InChIKey | SSRMPVDFDJCFNE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 4-triphenylsilylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-triphenylsilylphenol?
The IUPAC name of 4-triphenylsilylphenol (CID 3359842) is 4-triphenylsilylphenol.
What is the SMILES notation for 4-triphenylsilylphenol?
The canonical SMILES for 4-triphenylsilylphenol is Oc1ccc([Si](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 4-triphenylsilylphenol?
The InChIKey is SSRMPVDFDJCFNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20OSi/c25-20-16-18-24(19-17-20)26(21-10-4-1-5-11-21,22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-19,25H.
What are the key properties of 4-triphenylsilylphenol?
4-triphenylsilylphenol has a molecular weight of 352.51 g/mol, XLogP of 2.77, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-triphenylsilylphenol is sourced from PubChem (CID 3359842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).