C25H35N5O4 — CID 3360064
2-[cyclohexyl-[(4-nitrophenyl)carbamoyl]amino]-N-(2-methylpropyl)-N-[(1-methylpyrrol-2-yl)methyl]acetamide (PubChem CID 3360064) has the molecular formula C25H35N5O4 and a molecular weight of 469.59 g/mol. Its IUPAC name is 2-[cyclohexyl-[(4-nitrophenyl)carbamoyl]amino]-N-(2-methylpropyl)-N-[(1-methylpyrrol-2-yl)methyl]acetamide.
| Compound Name | 2-[cyclohexyl-[(4-nitrophenyl)carbamoyl]amino]-N-(2-methylpropyl)-N-[(1-methylpyrrol-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 3360064 |
| Molecular Formula | C25H35N5O4 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | 2-[cyclohexyl-[(4-nitrophenyl)carbamoyl]amino]-N-(2-methylpropyl)-N-[(1-methylpyrrol-2-yl)methyl]acetamide |
| SMILES | CC(C)CN(Cc1cccn1C)C(=O)CN(C(=O)Nc1ccc([N+](=O)[O-])cc1)C1CCCCC1 |
| InChI | InChI=1S/C25H35N5O4/c1-19(2)16-28(17-23-10-7-15-27(23)3)24(31)18-29(21-8-5-4-6-9-21)25(32)26-20-11-13-22(14-12-20)30(33)34/h7,10-15,19,21H,4-6,8-9,16-18H2,1-3H3,(H,26,32) |
| InChIKey | HUOYLCAQSTXUDU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|