About N'-(4-bromophenyl)-N,N-bis(4-hydroxyphenyl)benzenecarboximidamide
N'-(4-bromophenyl)-N,N-bis(4-hydroxyphenyl)benzenecarboximidamide (PubChem CID 3360452) has the molecular formula C25H19BrN2O2
and a molecular weight of 459.34 g/mol. Its IUPAC name is N'-(4-bromophenyl)-N,N-bis(4-hydroxyphenyl)benzenecarboximidamide.
Molecular Properties
| Compound Name | N'-(4-bromophenyl)-N,N-bis(4-hydroxyphenyl)benzenecarboximidamide |
| PubChem CID | 3360452 |
| Molecular Formula | C25H19BrN2O2 |
| Molecular Weight | 459.34 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | N'-(4-bromophenyl)-N,N-bis(4-hydroxyphenyl)benzenecarboximidamide |
| SMILES | Oc1ccc(N(/C(=N/c2ccc(Br)cc2)c2ccccc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C25H19BrN2O2/c26-19-6-8-20(9-7-19)27-25(18-4-2-1-3-5-18)28(21-10-14-23(29)15-11-21)22-12-16-24(30)17-13-22/h1-17,29-30H/b27-25+ |
| InChIKey | LWBAGYAEWOCZHJ-IMVLJIQESA-N |
| XLogP | 6.78 |
| TPSA | 56.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.34 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-bromophenyl)-N,N-bis(4-hydroxyphenyl)benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-bromophenyl)-N,N-bis(4-hydroxyphenyl)benzenecarboximidamide?
The IUPAC name of N'-(4-bromophenyl)-N,N-bis(4-hydroxyphenyl)benzenecarboximidamide (CID 3360452) is N'-(4-bromophenyl)-N,N-bis(4-hydroxyphenyl)benzenecarboximidamide.
What is the SMILES notation for N'-(4-bromophenyl)-N,N-bis(4-hydroxyphenyl)benzenecarboximidamide?
The canonical SMILES for N'-(4-bromophenyl)-N,N-bis(4-hydroxyphenyl)benzenecarboximidamide is Oc1ccc(N(/C(=N/c2ccc(Br)cc2)c2ccccc2)c2ccc(O)cc2)cc1.
What is the InChIKey of N'-(4-bromophenyl)-N,N-bis(4-hydroxyphenyl)benzenecarboximidamide?
The InChIKey is LWBAGYAEWOCZHJ-IMVLJIQESA-N. The full InChI is InChI=1S/C25H19BrN2O2/c26-19-6-8-20(9-7-19)27-25(18-4-2-1-3-5-18)28(21-10-14-23(29)15-11-21)22-12-16-24(30)17-13-22/h1-17,29-30H/b27-25+.
What are the key properties of N'-(4-bromophenyl)-N,N-bis(4-hydroxyphenyl)benzenecarboximidamide?
N'-(4-bromophenyl)-N,N-bis(4-hydroxyphenyl)benzenecarboximidamide has a molecular weight of 459.34 g/mol, XLogP of 6.78, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-bromophenyl)-N,N-bis(4-hydroxyphenyl)benzenecarboximidamide is sourced from PubChem (CID 3360452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).