About (6-methyl-3-pyridinyl) thiophene-2-carboxylate
(6-methyl-3-pyridinyl) thiophene-2-carboxylate (PubChem CID 3360611) has the molecular formula C11H9NO2S
and a molecular weight of 219.26 g/mol. Its IUPAC name is (6-methyl-3-pyridinyl) thiophene-2-carboxylate.
Molecular Properties
| Compound Name | (6-methyl-3-pyridinyl) thiophene-2-carboxylate |
| PubChem CID | 3360611 |
| Molecular Formula | C11H9NO2S |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | (6-methyl-3-pyridinyl) thiophene-2-carboxylate |
| SMILES | Cc1ccc(OC(=O)c2cccs2)cn1 |
| InChI | InChI=1S/C11H9NO2S/c1-8-4-5-9(7-12-8)14-11(13)10-3-2-6-15-10/h2-7H,1H3 |
| InChIKey | BLJRXJXOLZWTJS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-methyl-3-pyridinyl) thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methyl-3-pyridinyl) thiophene-2-carboxylate?
The IUPAC name of (6-methyl-3-pyridinyl) thiophene-2-carboxylate (CID 3360611) is (6-methyl-3-pyridinyl) thiophene-2-carboxylate.
What is the SMILES notation for (6-methyl-3-pyridinyl) thiophene-2-carboxylate?
The canonical SMILES for (6-methyl-3-pyridinyl) thiophene-2-carboxylate is Cc1ccc(OC(=O)c2cccs2)cn1.
What is the InChIKey of (6-methyl-3-pyridinyl) thiophene-2-carboxylate?
The InChIKey is BLJRXJXOLZWTJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO2S/c1-8-4-5-9(7-12-8)14-11(13)10-3-2-6-15-10/h2-7H,1H3.
What are the key properties of (6-methyl-3-pyridinyl) thiophene-2-carboxylate?
(6-methyl-3-pyridinyl) thiophene-2-carboxylate has a molecular weight of 219.26 g/mol, XLogP of 2.67, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methyl-3-pyridinyl) thiophene-2-carboxylate is sourced from PubChem (CID 3360611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).