C24H26N4O3S2 — CID 3360667
5-[[2-(furan-2-ylmethylamino)-7-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-hexyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3360667) has the molecular formula C24H26N4O3S2 and a molecular weight of 482.63 g/mol. Its IUPAC name is 5-[[2-(furan-2-ylmethylamino)-7-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-hexyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[2-(furan-2-ylmethylamino)-7-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-hexyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3360667 |
| Molecular Formula | C24H26N4O3S2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 5-[[2-(furan-2-ylmethylamino)-7-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylidene]-3-hexyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCCCCN1C(=O)C(=Cc2c(NCc3ccco3)nc3ccc(C)cn3c2=O)SC1=S |
| InChI | InChI=1S/C24H26N4O3S2/c1-3-4-5-6-11-27-23(30)19(33-24(27)32)13-18-21(25-14-17-8-7-12-31-17)26-20-10-9-16(2)15-28(20)22(18)29/h7-10,12-13,15,25H,3-6,11,14H2,1-2H3 |
| InChIKey | PVGNXHVWOZTOHJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 79.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|