C33H32FN3O2S — CID 3360849
3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-1-[4-(4-methoxyphenyl)piperazin-1-yl]-3-thiophen-3-ylpropan-1-one (PubChem CID 3360849) has the molecular formula C33H32FN3O2S and a molecular weight of 553.70 g/mol. Its IUPAC name is 3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-1-[4-(4-methoxyphenyl)piperazin-1-yl]-3-thiophen-3-ylpropan-1-one.
| Compound Name | 3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-1-[4-(4-methoxyphenyl)piperazin-1-yl]-3-thiophen-3-ylpropan-1-one |
|---|---|
| PubChem CID | 3360849 |
| Molecular Formula | C33H32FN3O2S |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | 3-[1-[(4-fluorophenyl)methyl]indol-3-yl]-1-[4-(4-methoxyphenyl)piperazin-1-yl]-3-thiophen-3-ylpropan-1-one |
| SMILES | COc1ccc(N2CCN(C(=O)CC(c3ccsc3)c3cn(Cc4ccc(F)cc4)c4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C33H32FN3O2S/c1-39-28-12-10-27(11-13-28)35-15-17-36(18-16-35)33(38)20-30(25-14-19-40-23-25)31-22-37(32-5-3-2-4-29(31)32)21-24-6-8-26(34)9-7-24/h2-14,19,22-23,30H,15-18,20-21H2,1H3 |
| InChIKey | HWKSDVYTSIVWJE-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|