C14H8Cl3NO — CID 3361368
4,5,6-trichloro-3-phenyl-1,3-dihydroindol-2-one (PubChem CID 3361368) has the molecular formula C14H8Cl3NO and a molecular weight of 312.58 g/mol. Its IUPAC name is 4,5,6-trichloro-3-phenyl-1,3-dihydroindol-2-one.
| Compound Name | 4,5,6-trichloro-3-phenyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 3361368 |
| Molecular Formula | C14H8Cl3NO |
| Molecular Weight | 312.58 g/mol |
| Exact Mass | 310.97 |
| IUPAC Name | 4,5,6-trichloro-3-phenyl-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2cc(Cl)c(Cl)c(Cl)c2C1c1ccccc1 |
| InChI | InChI=1S/C14H8Cl3NO/c15-8-6-9-11(13(17)12(8)16)10(14(19)18-9)7-4-2-1-3-5-7/h1-6,10H,(H,18,19) |
| InChIKey | DFZXOBNOUIIHBA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.58 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|