C19H18Cl2N4O4 — CID 3361883
1-N',5-N'-bis(4-chlorobenzoyl)pentanedihydrazide (PubChem CID 3361883) has the molecular formula C19H18Cl2N4O4 and a molecular weight of 437.28 g/mol. Its IUPAC name is 1-N',5-N'-bis(4-chlorobenzoyl)pentanedihydrazide.
| Compound Name | 1-N',5-N'-bis(4-chlorobenzoyl)pentanedihydrazide |
|---|---|
| PubChem CID | 3361883 |
| Molecular Formula | C19H18Cl2N4O4 |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | 1-N',5-N'-bis(4-chlorobenzoyl)pentanedihydrazide |
| SMILES | O=C(CCCC(=O)NNC(=O)c1ccc(Cl)cc1)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18Cl2N4O4/c20-14-8-4-12(5-9-14)18(28)24-22-16(26)2-1-3-17(27)23-25-19(29)13-6-10-15(21)11-7-13/h4-11H,1-3H2,(H,22,26)(H,23,27)(H,24,28)(H,25,29) |
| InChIKey | WETHYUXYNJSNJS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|