C17H17N3O2S2 — CID 3362077
2-[(2-phenylacetyl)carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide (PubChem CID 3362077) has the molecular formula C17H17N3O2S2 and a molecular weight of 359.48 g/mol. Its IUPAC name is 2-[(2-phenylacetyl)carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide.
| Compound Name | 2-[(2-phenylacetyl)carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 3362077 |
| Molecular Formula | C17H17N3O2S2 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2-[(2-phenylacetyl)carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=S)NC(=O)Cc2ccccc2)sc2c1CCC2 |
| InChI | InChI=1S/C17H17N3O2S2/c18-15(22)14-11-7-4-8-12(11)24-16(14)20-17(23)19-13(21)9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2,(H2,18,22)(H2,19,20,21,23) |
| InChIKey | MUCPSKOHVFRGPY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|