About 3,4-dinitrobenzaldehyde
3,4-dinitrobenzaldehyde (PubChem CID 3362201) has the molecular formula C7H4N2O5
and a molecular weight of 196.12 g/mol. Its IUPAC name is 3,4-dinitrobenzaldehyde.
Molecular Properties
| Compound Name | 3,4-dinitrobenzaldehyde |
| PubChem CID | 3362201 |
| Molecular Formula | C7H4N2O5 |
| Molecular Weight | 196.12 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | 3,4-dinitrobenzaldehyde |
| SMILES | O=Cc1ccc([N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H4N2O5/c10-4-5-1-2-6(8(11)12)7(3-5)9(13)14/h1-4H |
| InChIKey | HWEAXMDJIUCDRB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.12 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dinitrobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dinitrobenzaldehyde?
The IUPAC name of 3,4-dinitrobenzaldehyde (CID 3362201) is 3,4-dinitrobenzaldehyde.
What is the SMILES notation for 3,4-dinitrobenzaldehyde?
The canonical SMILES for 3,4-dinitrobenzaldehyde is O=Cc1ccc([N+](=O)[O-])c([N+](=O)[O-])c1.
What is the InChIKey of 3,4-dinitrobenzaldehyde?
The InChIKey is HWEAXMDJIUCDRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O5/c10-4-5-1-2-6(8(11)12)7(3-5)9(13)14/h1-4H.
What are the key properties of 3,4-dinitrobenzaldehyde?
3,4-dinitrobenzaldehyde has a molecular weight of 196.12 g/mol, XLogP of 1.32, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dinitrobenzaldehyde is sourced from PubChem (CID 3362201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).