C12H36N7P2+ — CID 3362224
tris(dimethylamino)-[[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium (PubChem CID 3362224) has the molecular formula C12H36N7P2+ and a molecular weight of 340.42 g/mol. Its IUPAC name is tris(dimethylamino)-[[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium.
| Compound Name | tris(dimethylamino)-[[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium |
|---|---|
| PubChem CID | 3362224 |
| Molecular Formula | C12H36N7P2+ |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | tris(dimethylamino)-[[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium |
| SMILES | CN(C)P(=N[P+](N(C)C)(N(C)C)N(C)C)(N(C)C)N(C)C |
| InChI | InChI=1S/C12H36N7P2/c1-14(2)20(15(3)4,16(5)6)13-21(17(7)8,18(9)10)19(11)12/h1-12H3/q+1 |
| InChIKey | SSPZXPJPAJQHQN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 31.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|