About 3,3-Diphenyl-2-(1-phenylethyl)-1,2-oxaziridine
3,3-Diphenyl-2-(1-phenylethyl)-1,2-oxaziridine (PubChem CID 336231) has the molecular formula C21H19NO
and a molecular weight of 301.40 g/mol. Its IUPAC name is 3,3-diphenyl-2-(1-phenylethyl)oxaziridine.
Molecular Properties
| Compound Name | 3,3-Diphenyl-2-(1-phenylethyl)-1,2-oxaziridine |
| PubChem CID | 336231 |
| Molecular Formula | C21H19NO |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 3,3-diphenyl-2-(1-phenylethyl)oxaziridine |
| SMILES | CC(C1=CC=CC=C1)N2C(O2)(C3=CC=CC=C3)C4=CC=CC=C4 |
| InChI | InChI=1S/C21H19NO/c1-17(18-11-5-2-6-12-18)22-21(23-22,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-17H,1H3 |
| InChIKey | OZSZMZQRLSYNMX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 15.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | 359 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3,3-Diphenyl-2-(1-phenylethyl)-1,2-oxaziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-Diphenyl-2-(1-phenylethyl)-1,2-oxaziridine?
The IUPAC name of 3,3-Diphenyl-2-(1-phenylethyl)-1,2-oxaziridine (CID 336231) is 3,3-diphenyl-2-(1-phenylethyl)oxaziridine.
What is the SMILES notation for 3,3-Diphenyl-2-(1-phenylethyl)-1,2-oxaziridine?
The canonical SMILES for 3,3-Diphenyl-2-(1-phenylethyl)-1,2-oxaziridine is CC(C1=CC=CC=C1)N2C(O2)(C3=CC=CC=C3)C4=CC=CC=C4.
What is the InChIKey of 3,3-Diphenyl-2-(1-phenylethyl)-1,2-oxaziridine?
The InChIKey is OZSZMZQRLSYNMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19NO/c1-17(18-11-5-2-6-12-18)22-21(23-22,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-17H,1H3.
What are the key properties of 3,3-Diphenyl-2-(1-phenylethyl)-1,2-oxaziridine?
3,3-Diphenyl-2-(1-phenylethyl)-1,2-oxaziridine has a molecular weight of 301.40 g/mol, XLogP of 5.10, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-Diphenyl-2-(1-phenylethyl)-1,2-oxaziridine is sourced from PubChem (CID 336231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).