C20H18N4OS — CID 3362502
6-amino-8-(4-ethoxyphenyl)-1,3,8,8a-tetrahydroisothiochromene-5,7,7-tricarbonitrile (PubChem CID 3362502) has the molecular formula C20H18N4OS and a molecular weight of 362.46 g/mol. Its IUPAC name is 6-amino-8-(4-ethoxyphenyl)-1,3,8,8a-tetrahydroisothiochromene-5,7,7-tricarbonitrile.
| Compound Name | 6-amino-8-(4-ethoxyphenyl)-1,3,8,8a-tetrahydroisothiochromene-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 3362502 |
| Molecular Formula | C20H18N4OS |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 6-amino-8-(4-ethoxyphenyl)-1,3,8,8a-tetrahydroisothiochromene-5,7,7-tricarbonitrile |
| SMILES | CCOc1ccc(C2C3CSCC=C3C(C#N)=C(N)C2(C#N)C#N)cc1 |
| InChI | InChI=1S/C20H18N4OS/c1-2-25-14-5-3-13(4-6-14)18-17-10-26-8-7-15(17)16(9-21)19(24)20(18,11-22)12-23/h3-7,17-18H,2,8,10,24H2,1H3 |
| InChIKey | SLRJTTUWNNQLAX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|