C22H12Cl2F2N4O2 — CID 3363897
1-(2,4-dichlorophenyl)-3-(2,4-difluorophenyl)-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 3363897) has the molecular formula C22H12Cl2F2N4O2 and a molecular weight of 473.27 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-(2,4-difluorophenyl)-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 1-(2,4-dichlorophenyl)-3-(2,4-difluorophenyl)-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 3363897 |
| Molecular Formula | C22H12Cl2F2N4O2 |
| Molecular Weight | 473.27 g/mol |
| Exact Mass | 472.03 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-(2,4-difluorophenyl)-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(c3ccc(Cl)cc3Cl)OC(c3ccc(F)cc3F)C(C#N)(C#N)C1(C#N)C2C |
| InChI | InChI=1S/C22H12Cl2F2N4O2/c1-11-21(10-29)19(30)32-22(11,15-5-2-12(23)6-16(15)24)31-18(20(21,8-27)9-28)14-4-3-13(25)7-17(14)26/h2-7,11,18,30H,1H3/b30-19- |
| InChIKey | JSPLNCXAEIOZMD-FSGOGVSDSA-N |
| XLogP | 5.38 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.27 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|