C38H50F3NO6 — CID 3363967
[5-[[2,3-dihydroxypropyl(oxolan-2-ylmethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 3363967) has the molecular formula C38H50F3NO6 and a molecular weight of 673.81 g/mol. Its IUPAC name is [5-[[2,3-dihydroxypropyl(oxolan-2-ylmethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [5-[[2,3-dihydroxypropyl(oxolan-2-ylmethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 3363967 |
| Molecular Formula | C38H50F3NO6 |
| Molecular Weight | 673.81 g/mol |
| Exact Mass | 673.36 |
| IUPAC Name | [5-[[2,3-dihydroxypropyl(oxolan-2-ylmethyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(CC(O)CO)CC2CCCO2)c2ccc(cc2C(=O)c2cccc(C(F)(F)F)c2)CC(O)CC1 |
| InChI | InChI=1S/C38H50F3NO6/c1-25-6-4-15-36(2)34(14-16-37(36,47)24-42(21-30(45)23-43)22-31-9-5-17-48-31)32-13-11-26(18-29(44)12-10-25)19-33(32)35(46)27-7-3-8-28(20-27)38(39,40)41/h3,6-8,11,13,19-20,29-31,34,43-45,47H,4-5,9-10,12,14-18,21-24H2,1-2H3 |
| InChIKey | KNVMFCBSEANJOE-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.81 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|