About propan-2-ylazanium
propan-2-ylazanium (PubChem CID 3364502) has the molecular formula C3H10N+
and a molecular weight of 60.12 g/mol. Its IUPAC name is propan-2-ylazanium.
Molecular Properties
| Compound Name | propan-2-ylazanium |
| PubChem CID | 3364502 |
| Molecular Formula | C3H10N+ |
| Molecular Weight | 60.12 g/mol |
| Exact Mass | 60.08 |
| IUPAC Name | propan-2-ylazanium |
| SMILES | CC(C)[NH3+] |
| InChI | InChI=1S/C3H9N/c1-3(2)4/h3H,4H2,1-2H3/p+1 |
| InChIKey | JJWLVOIRVHMVIS-UHFFFAOYSA-O |
| XLogP | -0.36 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 60.12 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze propan-2-ylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-ylazanium?
The IUPAC name of propan-2-ylazanium (CID 3364502) is propan-2-ylazanium.
What is the SMILES notation for propan-2-ylazanium?
The canonical SMILES for propan-2-ylazanium is CC(C)[NH3+].
What is the InChIKey of propan-2-ylazanium?
The InChIKey is JJWLVOIRVHMVIS-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H9N/c1-3(2)4/h3H,4H2,1-2H3/p+1.
What are the key properties of propan-2-ylazanium?
propan-2-ylazanium has a molecular weight of 60.12 g/mol, XLogP of -0.36, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-ylazanium is sourced from PubChem (CID 3364502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).