About 2-(3-amino-1H-1,2,4-triazol-5-yl)ethylazanium
2-(3-amino-1H-1,2,4-triazol-5-yl)ethylazanium (PubChem CID 3364740) has the molecular formula C4H10N5+
and a molecular weight of 128.16 g/mol. Its IUPAC name is 2-(3-amino-1H-1,2,4-triazol-5-yl)ethylazanium.
Molecular Properties
| Compound Name | 2-(3-amino-1H-1,2,4-triazol-5-yl)ethylazanium |
| PubChem CID | 3364740 |
| Molecular Formula | C4H10N5+ |
| Molecular Weight | 128.16 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | 2-(3-amino-1H-1,2,4-triazol-5-yl)ethylazanium |
| SMILES | Nc1n[nH]c(CC[NH3+])n1 |
| InChI | InChI=1S/C4H9N5/c5-2-1-3-7-4(6)9-8-3/h1-2,5H2,(H3,6,7,8,9)/p+1 |
| InChIKey | GNNXUWBCKBBJHF-UHFFFAOYSA-O |
| XLogP | -1.83 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.16 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-amino-1H-1,2,4-triazol-5-yl)ethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-amino-1H-1,2,4-triazol-5-yl)ethylazanium?
The IUPAC name of 2-(3-amino-1H-1,2,4-triazol-5-yl)ethylazanium (CID 3364740) is 2-(3-amino-1H-1,2,4-triazol-5-yl)ethylazanium.
What is the SMILES notation for 2-(3-amino-1H-1,2,4-triazol-5-yl)ethylazanium?
The canonical SMILES for 2-(3-amino-1H-1,2,4-triazol-5-yl)ethylazanium is Nc1n[nH]c(CC[NH3+])n1.
What is the InChIKey of 2-(3-amino-1H-1,2,4-triazol-5-yl)ethylazanium?
The InChIKey is GNNXUWBCKBBJHF-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H9N5/c5-2-1-3-7-4(6)9-8-3/h1-2,5H2,(H3,6,7,8,9)/p+1.
What are the key properties of 2-(3-amino-1H-1,2,4-triazol-5-yl)ethylazanium?
2-(3-amino-1H-1,2,4-triazol-5-yl)ethylazanium has a molecular weight of 128.16 g/mol, XLogP of -1.83, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-amino-1H-1,2,4-triazol-5-yl)ethylazanium is sourced from PubChem (CID 3364740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).