About methyl 3-benzoyl-4,5-dioxo-1-phenylpyrrole-2-carboxylate
methyl 3-benzoyl-4,5-dioxo-1-phenylpyrrole-2-carboxylate (PubChem CID 3365008) has the molecular formula C19H13NO5
and a molecular weight of 335.32 g/mol. Its IUPAC name is methyl 3-benzoyl-4,5-dioxo-1-phenylpyrrole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-benzoyl-4,5-dioxo-1-phenylpyrrole-2-carboxylate |
| PubChem CID | 3365008 |
| Molecular Formula | C19H13NO5 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | methyl 3-benzoyl-4,5-dioxo-1-phenylpyrrole-2-carboxylate |
| SMILES | COC(=O)C1=C(C(=O)c2ccccc2)C(=O)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C19H13NO5/c1-25-19(24)15-14(16(21)12-8-4-2-5-9-12)17(22)18(23)20(15)13-10-6-3-7-11-13/h2-11H,1H3 |
| InChIKey | JYEDPLXBJZTAMB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_fives(89)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-benzoyl-4,5-dioxo-1-phenylpyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-benzoyl-4,5-dioxo-1-phenylpyrrole-2-carboxylate?
The IUPAC name of methyl 3-benzoyl-4,5-dioxo-1-phenylpyrrole-2-carboxylate (CID 3365008) is methyl 3-benzoyl-4,5-dioxo-1-phenylpyrrole-2-carboxylate.
What is the SMILES notation for methyl 3-benzoyl-4,5-dioxo-1-phenylpyrrole-2-carboxylate?
The canonical SMILES for methyl 3-benzoyl-4,5-dioxo-1-phenylpyrrole-2-carboxylate is COC(=O)C1=C(C(=O)c2ccccc2)C(=O)C(=O)N1c1ccccc1.
What is the InChIKey of methyl 3-benzoyl-4,5-dioxo-1-phenylpyrrole-2-carboxylate?
The InChIKey is JYEDPLXBJZTAMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13NO5/c1-25-19(24)15-14(16(21)12-8-4-2-5-9-12)17(22)18(23)20(15)13-10-6-3-7-11-13/h2-11H,1H3.
What are the key properties of methyl 3-benzoyl-4,5-dioxo-1-phenylpyrrole-2-carboxylate?
methyl 3-benzoyl-4,5-dioxo-1-phenylpyrrole-2-carboxylate has a molecular weight of 335.32 g/mol, XLogP of 1.91, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-benzoyl-4,5-dioxo-1-phenylpyrrole-2-carboxylate is sourced from PubChem (CID 3365008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).