C14H15O8- — CID 3366939
methoxy-[2,3,5-tris(methoxycarbonyl)-4-methylcyclopenta-2,4-dien-1-ylidene]methanolate (PubChem CID 3366939) has the molecular formula C14H15O8- and a molecular weight of 311.27 g/mol. Its IUPAC name is methoxy-[2,3,5-tris(methoxycarbonyl)-4-methylcyclopenta-2,4-dien-1-ylidene]methanolate.
| Compound Name | methoxy-[2,3,5-tris(methoxycarbonyl)-4-methylcyclopenta-2,4-dien-1-ylidene]methanolate |
|---|---|
| PubChem CID | 3366939 |
| Molecular Formula | C14H15O8- |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | methoxy-[2,3,5-tris(methoxycarbonyl)-4-methylcyclopenta-2,4-dien-1-ylidene]methanolate |
| SMILES | COC(=O)C1=C(C)C(C(=O)OC)=C(C(=O)OC)C1=C([O-])OC |
| InChI | InChI=1S/C14H16O8/c1-6-7(11(15)19-2)9(13(17)21-4)10(14(18)22-5)8(6)12(16)20-3/h17H,1-5H3/p-1 |
| InChIKey | UFZQJNHNAIFDBZ-UHFFFAOYSA-M |
| XLogP | -0.65 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|