C29H40N2O2S — CID 3367388
3-(2,2-dimethyloxan-4-yl)-2-pentylsulfanylspiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one (PubChem CID 3367388) has the molecular formula C29H40N2O2S and a molecular weight of 480.72 g/mol. Its IUPAC name is 3-(2,2-dimethyloxan-4-yl)-2-pentylsulfanylspiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one.
| Compound Name | 3-(2,2-dimethyloxan-4-yl)-2-pentylsulfanylspiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one |
|---|---|
| PubChem CID | 3367388 |
| Molecular Formula | C29H40N2O2S |
| Molecular Weight | 480.72 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | 3-(2,2-dimethyloxan-4-yl)-2-pentylsulfanylspiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one |
| SMILES | CCCCCSc1nc2c(c(=O)n1C1CCOC(C)(C)C1)C1(CCCCC1)Cc1ccccc1-2 |
| InChI | InChI=1S/C29H40N2O2S/c1-4-5-11-18-34-27-30-25-23-13-8-7-12-21(23)19-29(15-9-6-10-16-29)24(25)26(32)31(27)22-14-17-33-28(2,3)20-22/h7-8,12-13,22H,4-6,9-11,14-20H2,1-3H3 |
| InChIKey | GCMAZKBCXWLYOR-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.72 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|