About 3-O-phenacyl 2-O-propyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate
3-O-phenacyl 2-O-propyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 3367701) has the molecular formula C20H22O5
and a molecular weight of 342.39 g/mol. Its IUPAC name is 3-O-phenacyl 2-O-propyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
Molecular Properties
| Compound Name | 3-O-phenacyl 2-O-propyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| PubChem CID | 3367701 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 3-O-phenacyl 2-O-propyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | CCCOC(=O)C1C2C=CC(C2)C1C(=O)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H22O5/c1-2-10-24-19(22)17-14-8-9-15(11-14)18(17)20(23)25-12-16(21)13-6-4-3-5-7-13/h3-9,14-15,17-18H,2,10-12H2,1H3 |
| InChIKey | NYFTUQKVWQQNEP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-O-phenacyl 2-O-propyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-phenacyl 2-O-propyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate?
The IUPAC name of 3-O-phenacyl 2-O-propyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (CID 3367701) is 3-O-phenacyl 2-O-propyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
What is the SMILES notation for 3-O-phenacyl 2-O-propyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate?
The canonical SMILES for 3-O-phenacyl 2-O-propyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate is CCCOC(=O)C1C2C=CC(C2)C1C(=O)OCC(=O)c1ccccc1.
What is the InChIKey of 3-O-phenacyl 2-O-propyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate?
The InChIKey is NYFTUQKVWQQNEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22O5/c1-2-10-24-19(22)17-14-8-9-15(11-14)18(17)20(23)25-12-16(21)13-6-4-3-5-7-13/h3-9,14-15,17-18H,2,10-12H2,1H3.
What are the key properties of 3-O-phenacyl 2-O-propyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate?
3-O-phenacyl 2-O-propyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate has a molecular weight of 342.39 g/mol, XLogP of 2.80, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-phenacyl 2-O-propyl bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate is sourced from PubChem (CID 3367701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).