C23H27F2N2O3+ — CID 3367896
2-[4-(difluoromethoxy)phenyl]-1-(4-ethoxyphenyl)-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol (PubChem CID 3367896) has the molecular formula C23H27F2N2O3+ and a molecular weight of 417.48 g/mol. Its IUPAC name is 2-[4-(difluoromethoxy)phenyl]-1-(4-ethoxyphenyl)-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol.
| Compound Name | 2-[4-(difluoromethoxy)phenyl]-1-(4-ethoxyphenyl)-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol |
|---|---|
| PubChem CID | 3367896 |
| Molecular Formula | C23H27F2N2O3+ |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 2-[4-(difluoromethoxy)phenyl]-1-(4-ethoxyphenyl)-3,5,6,7,8,9-hexahydroimidazo[1,2-a]azepin-4-ium-2-ol |
| SMILES | CCOc1ccc(N2C3=[N+](CCCCC3)CC2(O)c2ccc(OC(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H27F2N2O3/c1-2-29-19-13-9-18(10-14-19)27-21-6-4-3-5-15-26(21)16-23(27,28)17-7-11-20(12-8-17)30-22(24)25/h7-14,22,28H,2-6,15-16H2,1H3/q+1 |
| InChIKey | LWUPPCQEAPWKDY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 44.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|