C21H20O10S — CID 3368766
pentamethyl 5-phenylsulfanylcyclopenta-1,3-diene-1,2,3,4,5-pentacarboxylate (PubChem CID 3368766) has the molecular formula C21H20O10S and a molecular weight of 464.45 g/mol. Its IUPAC name is pentamethyl 5-phenylsulfanylcyclopenta-1,3-diene-1,2,3,4,5-pentacarboxylate.
| Compound Name | pentamethyl 5-phenylsulfanylcyclopenta-1,3-diene-1,2,3,4,5-pentacarboxylate |
|---|---|
| PubChem CID | 3368766 |
| Molecular Formula | C21H20O10S |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | pentamethyl 5-phenylsulfanylcyclopenta-1,3-diene-1,2,3,4,5-pentacarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(Sc2ccccc2)(C(=O)OC)C(C(=O)OC)=C1C(=O)OC |
| InChI | InChI=1S/C21H20O10S/c1-27-16(22)12-13(17(23)28-2)15(19(25)30-4)21(20(26)31-5,14(12)18(24)29-3)32-11-9-7-6-8-10-11/h6-10H,1-5H3 |
| InChIKey | OCWKNVROGMFJDP-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|