About N-bis(2-methylimidazo[1,2-a]pyridin-3-yl)phosphinothioyl-N-ethylethanamine
N-bis(2-methylimidazo[1,2-a]pyridin-3-yl)phosphinothioyl-N-ethylethanamine (PubChem CID 3369283) has the molecular formula C20H24N5PS
and a molecular weight of 397.49 g/mol. Its IUPAC name is N-bis(2-methylimidazo[1,2-a]pyridin-3-yl)phosphinothioyl-N-ethylethanamine.
Molecular Properties
| Compound Name | N-bis(2-methylimidazo[1,2-a]pyridin-3-yl)phosphinothioyl-N-ethylethanamine |
| PubChem CID | 3369283 |
| Molecular Formula | C20H24N5PS |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | N-bis(2-methylimidazo[1,2-a]pyridin-3-yl)phosphinothioyl-N-ethylethanamine |
| SMILES | CCN(CC)P(=S)(c1c(C)nc2ccccn12)c1c(C)nc2ccccn12 |
| InChI | InChI=1S/C20H24N5PS/c1-5-23(6-2)26(27,19-15(3)21-17-11-7-9-13-24(17)19)20-16(4)22-18-12-8-10-14-25(18)20/h7-14H,5-6H2,1-4H3 |
| InChIKey | SUNPCEGMYDDMFZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 37.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-bis(2-methylimidazo[1,2-a]pyridin-3-yl)phosphinothioyl-N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-bis(2-methylimidazo[1,2-a]pyridin-3-yl)phosphinothioyl-N-ethylethanamine?
The IUPAC name of N-bis(2-methylimidazo[1,2-a]pyridin-3-yl)phosphinothioyl-N-ethylethanamine (CID 3369283) is N-bis(2-methylimidazo[1,2-a]pyridin-3-yl)phosphinothioyl-N-ethylethanamine.
What is the SMILES notation for N-bis(2-methylimidazo[1,2-a]pyridin-3-yl)phosphinothioyl-N-ethylethanamine?
The canonical SMILES for N-bis(2-methylimidazo[1,2-a]pyridin-3-yl)phosphinothioyl-N-ethylethanamine is CCN(CC)P(=S)(c1c(C)nc2ccccn12)c1c(C)nc2ccccn12.
What is the InChIKey of N-bis(2-methylimidazo[1,2-a]pyridin-3-yl)phosphinothioyl-N-ethylethanamine?
The InChIKey is SUNPCEGMYDDMFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N5PS/c1-5-23(6-2)26(27,19-15(3)21-17-11-7-9-13-24(17)19)20-16(4)22-18-12-8-10-14-25(18)20/h7-14H,5-6H2,1-4H3.
What are the key properties of N-bis(2-methylimidazo[1,2-a]pyridin-3-yl)phosphinothioyl-N-ethylethanamine?
N-bis(2-methylimidazo[1,2-a]pyridin-3-yl)phosphinothioyl-N-ethylethanamine has a molecular weight of 397.49 g/mol, XLogP of 3.29, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-bis(2-methylimidazo[1,2-a]pyridin-3-yl)phosphinothioyl-N-ethylethanamine is sourced from PubChem (CID 3369283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).