C20H14F3N3O — CID 3369928
2-amino-6-(4-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]pyridine-3-carbonitrile (PubChem CID 3369928) has the molecular formula C20H14F3N3O and a molecular weight of 369.35 g/mol. Its IUPAC name is 2-amino-6-(4-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]pyridine-3-carbonitrile.
| Compound Name | 2-amino-6-(4-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3369928 |
| Molecular Formula | C20H14F3N3O |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 2-amino-6-(4-methoxyphenyl)-4-[3-(trifluoromethyl)phenyl]pyridine-3-carbonitrile |
| SMILES | COc1ccc(-c2cc(-c3cccc(C(F)(F)F)c3)c(C#N)c(N)n2)cc1 |
| InChI | InChI=1S/C20H14F3N3O/c1-27-15-7-5-12(6-8-15)18-10-16(17(11-24)19(25)26-18)13-3-2-4-14(9-13)20(21,22)23/h2-10H,1H3,(H2,25,26) |
| InChIKey | LELHGWXQGLURKZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |