About ethyl 4-amino-8-chloro-2-sulfanylidene-1,5-dihydro-1,5-benzodiazepine-3-carboxylate
ethyl 4-amino-8-chloro-2-sulfanylidene-1,5-dihydro-1,5-benzodiazepine-3-carboxylate (PubChem CID 3370267) has the molecular formula C12H12ClN3O2S
and a molecular weight of 297.77 g/mol. Its IUPAC name is ethyl 4-amino-8-chloro-2-sulfanylidene-1,5-dihydro-1,5-benzodiazepine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-amino-8-chloro-2-sulfanylidene-1,5-dihydro-1,5-benzodiazepine-3-carboxylate |
| PubChem CID | 3370267 |
| Molecular Formula | C12H12ClN3O2S |
| Molecular Weight | 297.77 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | ethyl 4-amino-8-chloro-2-sulfanylidene-1,5-dihydro-1,5-benzodiazepine-3-carboxylate |
| SMILES | CCOC(=O)C1=C(N)Nc2ccc(Cl)cc2NC1=S |
| InChI | InChI=1S/C12H12ClN3O2S/c1-2-18-12(17)9-10(14)15-7-4-3-6(13)5-8(7)16-11(9)19/h3-5,15H,2,14H2,1H3,(H,16,19) |
| InChIKey | DHYXQIOEZBQHJO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.77 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-amino-8-chloro-2-sulfanylidene-1,5-dihydro-1,5-benzodiazepine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-amino-8-chloro-2-sulfanylidene-1,5-dihydro-1,5-benzodiazepine-3-carboxylate?
The IUPAC name of ethyl 4-amino-8-chloro-2-sulfanylidene-1,5-dihydro-1,5-benzodiazepine-3-carboxylate (CID 3370267) is ethyl 4-amino-8-chloro-2-sulfanylidene-1,5-dihydro-1,5-benzodiazepine-3-carboxylate.
What is the SMILES notation for ethyl 4-amino-8-chloro-2-sulfanylidene-1,5-dihydro-1,5-benzodiazepine-3-carboxylate?
The canonical SMILES for ethyl 4-amino-8-chloro-2-sulfanylidene-1,5-dihydro-1,5-benzodiazepine-3-carboxylate is CCOC(=O)C1=C(N)Nc2ccc(Cl)cc2NC1=S.
What is the InChIKey of ethyl 4-amino-8-chloro-2-sulfanylidene-1,5-dihydro-1,5-benzodiazepine-3-carboxylate?
The InChIKey is DHYXQIOEZBQHJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClN3O2S/c1-2-18-12(17)9-10(14)15-7-4-3-6(13)5-8(7)16-11(9)19/h3-5,15H,2,14H2,1H3,(H,16,19).
What are the key properties of ethyl 4-amino-8-chloro-2-sulfanylidene-1,5-dihydro-1,5-benzodiazepine-3-carboxylate?
ethyl 4-amino-8-chloro-2-sulfanylidene-1,5-dihydro-1,5-benzodiazepine-3-carboxylate has a molecular weight of 297.77 g/mol, XLogP of 2.24, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-amino-8-chloro-2-sulfanylidene-1,5-dihydro-1,5-benzodiazepine-3-carboxylate is sourced from PubChem (CID 3370267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).