About 2-(3,4-difluorophenyl)-3-(4-ethoxyphenyl)-1,3-thiazolidin-4-one
2-(3,4-difluorophenyl)-3-(4-ethoxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 3370397) has the molecular formula C17H15F2NO2S
and a molecular weight of 335.38 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-3-(4-ethoxyphenyl)-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 2-(3,4-difluorophenyl)-3-(4-ethoxyphenyl)-1,3-thiazolidin-4-one |
| PubChem CID | 3370397 |
| Molecular Formula | C17H15F2NO2S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 2-(3,4-difluorophenyl)-3-(4-ethoxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | CCOc1ccc(N2C(=O)CSC2c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C17H15F2NO2S/c1-2-22-13-6-4-12(5-7-13)20-16(21)10-23-17(20)11-3-8-14(18)15(19)9-11/h3-9,17H,2,10H2,1H3 |
| InChIKey | DKENRGMTOVAWDK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,4-difluorophenyl)-3-(4-ethoxyphenyl)-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-difluorophenyl)-3-(4-ethoxyphenyl)-1,3-thiazolidin-4-one?
The IUPAC name of 2-(3,4-difluorophenyl)-3-(4-ethoxyphenyl)-1,3-thiazolidin-4-one (CID 3370397) is 2-(3,4-difluorophenyl)-3-(4-ethoxyphenyl)-1,3-thiazolidin-4-one.
What is the SMILES notation for 2-(3,4-difluorophenyl)-3-(4-ethoxyphenyl)-1,3-thiazolidin-4-one?
The canonical SMILES for 2-(3,4-difluorophenyl)-3-(4-ethoxyphenyl)-1,3-thiazolidin-4-one is CCOc1ccc(N2C(=O)CSC2c2ccc(F)c(F)c2)cc1.
What is the InChIKey of 2-(3,4-difluorophenyl)-3-(4-ethoxyphenyl)-1,3-thiazolidin-4-one?
The InChIKey is DKENRGMTOVAWDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F2NO2S/c1-2-22-13-6-4-12(5-7-13)20-16(21)10-23-17(20)11-3-8-14(18)15(19)9-11/h3-9,17H,2,10H2,1H3.
What are the key properties of 2-(3,4-difluorophenyl)-3-(4-ethoxyphenyl)-1,3-thiazolidin-4-one?
2-(3,4-difluorophenyl)-3-(4-ethoxyphenyl)-1,3-thiazolidin-4-one has a molecular weight of 335.38 g/mol, XLogP of 4.14, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-difluorophenyl)-3-(4-ethoxyphenyl)-1,3-thiazolidin-4-one is sourced from PubChem (CID 3370397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).