C17H18ClNOS3 — CID 3370833
2-chloro-1-(4,4,7,8-tetramethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)propan-1-one (PubChem CID 3370833) has the molecular formula C17H18ClNOS3 and a molecular weight of 383.99 g/mol. Its IUPAC name is 2-chloro-1-(4,4,7,8-tetramethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)propan-1-one.
| Compound Name | 2-chloro-1-(4,4,7,8-tetramethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)propan-1-one |
|---|---|
| PubChem CID | 3370833 |
| Molecular Formula | C17H18ClNOS3 |
| Molecular Weight | 383.99 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | 2-chloro-1-(4,4,7,8-tetramethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)propan-1-one |
| SMILES | Cc1cc2c(cc1C)N(C(=O)C(C)Cl)C(C)(C)c1ssc(=S)c1-2 |
| InChI | InChI=1S/C17H18ClNOS3/c1-8-6-11-12(7-9(8)2)19(15(20)10(3)18)17(4,5)14-13(11)16(21)23-22-14/h6-7,10H,1-5H3 |
| InChIKey | DOHOBENYMKYKBK-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.99 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|